C11H12N3O5P — CID 68765486
3-aminoprop-2-enylphosphonic acid;quinoxaline-2,3-dione (PubChem CID 68765486) has the molecular formula C11H12N3O5P and a molecular weight of 297.21 g/mol. Its IUPAC name is 3-aminoprop-2-enylphosphonic acid;quinoxaline-2,3-dione.
| Compound Name | 3-aminoprop-2-enylphosphonic acid;quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 68765486 |
| Molecular Formula | C11H12N3O5P |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 3-aminoprop-2-enylphosphonic acid;quinoxaline-2,3-dione |
| SMILES | NC=CCP(=O)(O)O.O=C1N=c2ccccc2=NC1=O |
| InChI | InChI=1S/C8H4N2O2.C3H8NO3P/c11-7-8(12)10-6-4-2-1-3-5(6)9-7;4-2-1-3-8(5,6)7/h1-4H;1-2H,3-4H2,(H2,5,6,7) |
| InChIKey | RUYUYCLOTNLSHX-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 142.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|