C19H24Cl2N2O2 — CID 68769938
(3S)-1-[[(4S,5R)-5-amino-4-(2,4-dichlorophenyl)cyclohexen-1-yl]methyl]piperidine-3-carboxylic acid (PubChem CID 68769938) has the molecular formula C19H24Cl2N2O2 and a molecular weight of 383.32 g/mol. Its IUPAC name is (3S)-1-[[(4S,5R)-5-amino-4-(2,4-dichlorophenyl)cyclohexen-1-yl]methyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[[(4S,5R)-5-amino-4-(2,4-dichlorophenyl)cyclohexen-1-yl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 68769938 |
| Molecular Formula | C19H24Cl2N2O2 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (3S)-1-[[(4S,5R)-5-amino-4-(2,4-dichlorophenyl)cyclohexen-1-yl]methyl]piperidine-3-carboxylic acid |
| SMILES | N[C@@H]1CC(CN2CCC[C@H](C(=O)O)C2)=CC[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H24Cl2N2O2/c20-14-4-6-15(17(21)9-14)16-5-3-12(8-18(16)22)10-23-7-1-2-13(11-23)19(24)25/h3-4,6,9,13,16,18H,1-2,5,7-8,10-11,22H2,(H,24,25)/t13-,16-,18+/m0/s1 |
| InChIKey | KPZYCJYDAVLKQS-QANKJYHBSA-N |
| XLogP | 3.92 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|