C28H35ClN2O — CID 68773523
1-[3-(4-chlorophenoxy)phenyl]-5-methyl-3-N-(3-phenylpropyl)hexane-2,3-diamine (PubChem CID 68773523) has the molecular formula C28H35ClN2O and a molecular weight of 451.05 g/mol. Its IUPAC name is 1-[3-(4-chlorophenoxy)phenyl]-5-methyl-3-N-(3-phenylpropyl)hexane-2,3-diamine.
| Compound Name | 1-[3-(4-chlorophenoxy)phenyl]-5-methyl-3-N-(3-phenylpropyl)hexane-2,3-diamine |
|---|---|
| PubChem CID | 68773523 |
| Molecular Formula | C28H35ClN2O |
| Molecular Weight | 451.05 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 1-[3-(4-chlorophenoxy)phenyl]-5-methyl-3-N-(3-phenylpropyl)hexane-2,3-diamine |
| SMILES | CC(C)CC(NCCCc1ccccc1)C(N)Cc1cccc(Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C28H35ClN2O/c1-21(2)18-28(31-17-7-11-22-8-4-3-5-9-22)27(30)20-23-10-6-12-26(19-23)32-25-15-13-24(29)14-16-25/h3-6,8-10,12-16,19,21,27-28,31H,7,11,17-18,20,30H2,1-2H3 |
| InChIKey | GCCGPEMOAADEOQ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.05 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|