C22H19Cl3N4O3S2 — CID 68773830
2-chloro-N-[2-(3,4-dichlorophenyl)propyl]-6-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide (PubChem CID 68773830) has the molecular formula C22H19Cl3N4O3S2 and a molecular weight of 557.91 g/mol. Its IUPAC name is 2-chloro-N-[2-(3,4-dichlorophenyl)propyl]-6-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide.
| Compound Name | 2-chloro-N-[2-(3,4-dichlorophenyl)propyl]-6-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 68773830 |
| Molecular Formula | C22H19Cl3N4O3S2 |
| Molecular Weight | 557.91 g/mol |
| Exact Mass | 556.00 |
| IUPAC Name | 2-chloro-N-[2-(3,4-dichlorophenyl)propyl]-6-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonylamino)benzamide |
| SMILES | CC(CNC(=O)c1c(Cl)cccc1NS(=O)(=O)C1=CC=CN2SNC=C12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H19Cl3N4O3S2/c1-13(14-7-8-15(23)17(25)10-14)11-26-22(30)21-16(24)4-2-5-18(21)28-34(31,32)20-6-3-9-29-19(20)12-27-33-29/h2-10,12-13,27-28H,11H2,1H3,(H,26,30) |
| InChIKey | IUSBTAQYXDENFU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.91 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|