C29H40N4O3 — CID 68780648
N-[1-[(8-ethoxy-2,2-dimethylchromen-6-yl)methyl]piperidin-4-yl]-5,5,7,7-tetramethylfuro[3,4-d]pyrimidin-2-amine (PubChem CID 68780648) has the molecular formula C29H40N4O3 and a molecular weight of 492.66 g/mol. Its IUPAC name is N-[1-[(8-ethoxy-2,2-dimethylchromen-6-yl)methyl]piperidin-4-yl]-5,5,7,7-tetramethylfuro[3,4-d]pyrimidin-2-amine.
| Compound Name | N-[1-[(8-ethoxy-2,2-dimethylchromen-6-yl)methyl]piperidin-4-yl]-5,5,7,7-tetramethylfuro[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 68780648 |
| Molecular Formula | C29H40N4O3 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | N-[1-[(8-ethoxy-2,2-dimethylchromen-6-yl)methyl]piperidin-4-yl]-5,5,7,7-tetramethylfuro[3,4-d]pyrimidin-2-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3ncc4c(n3)C(C)(C)OC4(C)C)CC2)cc2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C29H40N4O3/c1-8-34-23-16-19(15-20-9-12-27(2,3)35-24(20)23)18-33-13-10-21(11-14-33)31-26-30-17-22-25(32-26)29(6,7)36-28(22,4)5/h9,12,15-17,21H,8,10-11,13-14,18H2,1-7H3,(H,30,31,32) |
| InChIKey | NHWWWDCLPIMJRQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |