C20H20BrN3O4S — CID 6878396
ethyl 5-[2-[(2E)-2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-2-oxoethoxy]-1,2-dimethylindole-3-carboxylate (PubChem CID 6878396) has the molecular formula C20H20BrN3O4S and a molecular weight of 478.37 g/mol. Its IUPAC name is ethyl 5-[2-[(2E)-2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-2-oxoethoxy]-1,2-dimethylindole-3-carboxylate.
| Compound Name | ethyl 5-[2-[(2E)-2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-2-oxoethoxy]-1,2-dimethylindole-3-carboxylate |
|---|---|
| PubChem CID | 6878396 |
| Molecular Formula | C20H20BrN3O4S |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | ethyl 5-[2-[(2E)-2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-2-oxoethoxy]-1,2-dimethylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(C)c2ccc(OCC(=O)N/N=C/c3cc(Br)cs3)cc12 |
| InChI | InChI=1S/C20H20BrN3O4S/c1-4-27-20(26)19-12(2)24(3)17-6-5-14(8-16(17)19)28-10-18(25)23-22-9-15-7-13(21)11-29-15/h5-9,11H,4,10H2,1-3H3,(H,23,25)/b22-9+ |
| InChIKey | YCLVTGORFGULHM-LSFURLLWSA-N |
| XLogP | 4.02 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|