C22H25O3P — CID 68793577
[2-[1-ethyl-4-(4-ethylphenyl)cyclohexa-2,4-dien-1-yl]phenyl]phosphonic acid (PubChem CID 68793577) has the molecular formula C22H25O3P and a molecular weight of 368.41 g/mol. Its IUPAC name is [2-[1-ethyl-4-(4-ethylphenyl)cyclohexa-2,4-dien-1-yl]phenyl]phosphonic acid.
| Compound Name | [2-[1-ethyl-4-(4-ethylphenyl)cyclohexa-2,4-dien-1-yl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 68793577 |
| Molecular Formula | C22H25O3P |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [2-[1-ethyl-4-(4-ethylphenyl)cyclohexa-2,4-dien-1-yl]phenyl]phosphonic acid |
| SMILES | CCc1ccc(C2=CCC(CC)(c3ccccc3P(=O)(O)O)C=C2)cc1 |
| InChI | InChI=1S/C22H25O3P/c1-3-17-9-11-18(12-10-17)19-13-15-22(4-2,16-14-19)20-7-5-6-8-21(20)26(23,24)25/h5-15H,3-4,16H2,1-2H3,(H2,23,24,25) |
| InChIKey | LUSHUYPDDUMFIC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|