C12H15ClN2O4S — CID 68793612
2-chloroethyl N-[(2-prop-2-enylphenyl)sulfamoyl]carbamate (PubChem CID 68793612) has the molecular formula C12H15ClN2O4S and a molecular weight of 318.78 g/mol. Its IUPAC name is 2-chloroethyl N-[(2-prop-2-enylphenyl)sulfamoyl]carbamate.
| Compound Name | 2-chloroethyl N-[(2-prop-2-enylphenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 68793612 |
| Molecular Formula | C12H15ClN2O4S |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-chloroethyl N-[(2-prop-2-enylphenyl)sulfamoyl]carbamate |
| SMILES | C=CCc1ccccc1NS(=O)(=O)NC(=O)OCCCl |
| InChI | InChI=1S/C12H15ClN2O4S/c1-2-5-10-6-3-4-7-11(10)14-20(17,18)15-12(16)19-9-8-13/h2-4,6-7,14H,1,5,8-9H2,(H,15,16) |
| InChIKey | YKTCNLYTBVABES-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|