About 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate
2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate (PubChem CID 68797498) has the molecular formula C17H17F2NO2S
and a molecular weight of 337.39 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate |
| PubChem CID | 68797498 |
| Molecular Formula | C17H17F2NO2S |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate |
| SMILES | CN(C)CCOC(=O)c1cc(-c2ccc(F)cc2F)ccc1S |
| InChI | InChI=1S/C17H17F2NO2S/c1-20(2)7-8-22-17(21)14-9-11(3-6-16(14)23)13-5-4-12(18)10-15(13)19/h3-6,9-10,23H,7-8H2,1-2H3 |
| InChIKey | KQESGBUBXQKXGO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate?
The IUPAC name of 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate (CID 68797498) is 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate.
What is the SMILES notation for 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate?
The canonical SMILES for 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate is CN(C)CCOC(=O)c1cc(-c2ccc(F)cc2F)ccc1S.
What is the InChIKey of 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate?
The InChIKey is KQESGBUBXQKXGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2NO2S/c1-20(2)7-8-22-17(21)14-9-11(3-6-16(14)23)13-5-4-12(18)10-15(13)19/h3-6,9-10,23H,7-8H2,1-2H3.
What are the key properties of 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate?
2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate has a molecular weight of 337.39 g/mol, XLogP of 3.64, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate is sourced from PubChem (CID 68797498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).