C17H17F2NO2S — CID 68797498
2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate (PubChem CID 68797498) has the molecular formula C17H17F2NO2S and a molecular weight of 337.39 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate.
| Compound Name | 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate |
|---|---|
| PubChem CID | 68797498 |
| Molecular Formula | C17H17F2NO2S |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-(dimethylamino)ethyl 5-(2,4-difluorophenyl)-2-sulfanylbenzoate |
| SMILES | CN(C)CCOC(=O)c1cc(-c2ccc(F)cc2F)ccc1S |
| InChI | InChI=1S/C17H17F2NO2S/c1-20(2)7-8-22-17(21)14-9-11(3-6-16(14)23)13-5-4-12(18)10-15(13)19/h3-6,9-10,23H,7-8H2,1-2H3 |
| InChIKey | KQESGBUBXQKXGO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|