C37H42Br2O2Si2 — CID 68800956
CID 68800956 (PubChem CID 68800956) has the molecular formula C37H42Br2O2Si2 and a molecular weight of 734.72 g/mol.
| Compound Name | CID 68800956 |
|---|---|
| PubChem CID | 68800956 |
| Molecular Formula | C37H42Br2O2Si2 |
| Molecular Weight | 734.72 g/mol |
| Exact Mass | 732.11 |
| IUPAC Name | — |
| SMILES | C[Si](C)Oc1cc(C(C)(C)C)ccc1C1(c2ccc(C(C)(C)C)cc2O[Si](C)C)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C37H42Br2O2Si2/c1-35(2,3)23-11-17-29(33(19-23)40-42(7)8)37(30-18-12-24(36(4,5)6)20-34(30)41-43(9)10)31-21-25(38)13-15-27(31)28-16-14-26(39)22-32(28)37/h11-22H,1-10H3 |
| InChIKey | DZCXHSMWBRARGR-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.72 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|