About 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide
4H-pyrrolo[2,3-c]pyridine-5-sulfonamide (PubChem CID 68803441) has the molecular formula C7H7N3O2S
and a molecular weight of 197.22 g/mol. Its IUPAC name is 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide.
Molecular Properties
| Compound Name | 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide |
| PubChem CID | 68803441 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide |
| SMILES | NS(=O)(=O)C1=NC=C2N=CC=C2C1 |
| InChI | InChI=1S/C7H7N3O2S/c8-13(11,12)7-3-5-1-2-9-6(5)4-10-7/h1-2,4H,3H2,(H2,8,11,12) |
| InChIKey | BPJVODCPHLDSJW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide?
The IUPAC name of 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide (CID 68803441) is 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide.
What is the SMILES notation for 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide?
The canonical SMILES for 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide is NS(=O)(=O)C1=NC=C2N=CC=C2C1.
What is the InChIKey of 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide?
The InChIKey is BPJVODCPHLDSJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2S/c8-13(11,12)7-3-5-1-2-9-6(5)4-10-7/h1-2,4H,3H2,(H2,8,11,12).
What are the key properties of 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide?
4H-pyrrolo[2,3-c]pyridine-5-sulfonamide has a molecular weight of 197.22 g/mol, XLogP of -0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide is sourced from PubChem (CID 68803441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).