C25H37N3O6S — CID 68811322
2-[3-[4-[(2-heptan-2-yl-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl)oxy]butoxy]phenyl]sulfanyl-2-methylpropanoic acid (PubChem CID 68811322) has the molecular formula C25H37N3O6S and a molecular weight of 507.65 g/mol. Its IUPAC name is 2-[3-[4-[(2-heptan-2-yl-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl)oxy]butoxy]phenyl]sulfanyl-2-methylpropanoic acid.
| Compound Name | 2-[3-[4-[(2-heptan-2-yl-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl)oxy]butoxy]phenyl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 68811322 |
| Molecular Formula | C25H37N3O6S |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 2-[3-[4-[(2-heptan-2-yl-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl)oxy]butoxy]phenyl]sulfanyl-2-methylpropanoic acid |
| SMILES | CCCCCC(C)n1nc(OCCCCOc2cccc(SC(C)(C)C(=O)O)c2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C25H37N3O6S/c1-6-7-8-12-18(2)28-24(32)27(5)22(29)21(26-28)34-16-10-9-15-33-19-13-11-14-20(17-19)35-25(3,4)23(30)31/h11,13-14,17-18H,6-10,12,15-16H2,1-5H3,(H,30,31) |
| InChIKey | VSGZCORBBXZWFS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|