C19H19N5O3 — CID 6881703
N-[4-[[2-methoxy-5-[(E)-1,2,4-triazol-1-yliminomethyl]phenyl]methoxy]phenyl]acetamide (PubChem CID 6881703) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-[4-[[2-methoxy-5-[(E)-1,2,4-triazol-1-yliminomethyl]phenyl]methoxy]phenyl]acetamide.
| Compound Name | N-[4-[[2-methoxy-5-[(E)-1,2,4-triazol-1-yliminomethyl]phenyl]methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 6881703 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-[4-[[2-methoxy-5-[(E)-1,2,4-triazol-1-yliminomethyl]phenyl]methoxy]phenyl]acetamide |
| SMILES | COc1ccc(/C=N/n2cncn2)cc1COc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C19H19N5O3/c1-14(25)23-17-4-6-18(7-5-17)27-11-16-9-15(3-8-19(16)26-2)10-21-24-13-20-12-22-24/h3-10,12-13H,11H2,1-2H3,(H,23,25)/b21-10+ |
| InChIKey | VYLGMWCRBKYULH-UFFVCSGVSA-N |
| XLogP | 2.71 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|