C16H12Cl2N2O2 — CID 68819345
3-(3-aminophenyl)-5,7-dichloro-3-methyl-1H-quinoline-2,4-dione (PubChem CID 68819345) has the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.19 g/mol. Its IUPAC name is 3-(3-aminophenyl)-5,7-dichloro-3-methyl-1H-quinoline-2,4-dione.
| Compound Name | 3-(3-aminophenyl)-5,7-dichloro-3-methyl-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 68819345 |
| Molecular Formula | C16H12Cl2N2O2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3-(3-aminophenyl)-5,7-dichloro-3-methyl-1H-quinoline-2,4-dione |
| SMILES | CC1(c2cccc(N)c2)C(=O)Nc2cc(Cl)cc(Cl)c2C1=O |
| InChI | InChI=1S/C16H12Cl2N2O2/c1-16(8-3-2-4-10(19)5-8)14(21)13-11(18)6-9(17)7-12(13)20-15(16)22/h2-7H,19H2,1H3,(H,20,22) |
| InChIKey | YSBPLJFVARHEQG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|