C16H19N2O3S2- — CID 68822740
2-[[3-(diethylcarbamoyl)phenyl]methyl-sulfinatoamino]thiophene (PubChem CID 68822740) has the molecular formula C16H19N2O3S2- and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-[[3-(diethylcarbamoyl)phenyl]methyl-sulfinatoamino]thiophene.
| Compound Name | 2-[[3-(diethylcarbamoyl)phenyl]methyl-sulfinatoamino]thiophene |
|---|---|
| PubChem CID | 68822740 |
| Molecular Formula | C16H19N2O3S2- |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-[[3-(diethylcarbamoyl)phenyl]methyl-sulfinatoamino]thiophene |
| SMILES | CCN(CC)C(=O)c1cccc(CN(c2cccs2)S(=O)[O-])c1 |
| InChI | InChI=1S/C16H20N2O3S2/c1-3-17(4-2)16(19)14-8-5-7-13(11-14)12-18(23(20)21)15-9-6-10-22-15/h5-11H,3-4,12H2,1-2H3,(H,20,21)/p-1 |
| InChIKey | SLWNGOCHBAWSIQ-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|