C23H25N3O4S — CID 68822014
5-[[3-(diethylcarbamoyl)phenyl]methyl-sulfinoamino]-2-phenoxypyridine (PubChem CID 68822014) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is 5-[[3-(diethylcarbamoyl)phenyl]methyl-sulfinoamino]-2-phenoxypyridine.
| Compound Name | 5-[[3-(diethylcarbamoyl)phenyl]methyl-sulfinoamino]-2-phenoxypyridine |
|---|---|
| PubChem CID | 68822014 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 5-[[3-(diethylcarbamoyl)phenyl]methyl-sulfinoamino]-2-phenoxypyridine |
| SMILES | CCN(CC)C(=O)c1cccc(CN(c2ccc(Oc3ccccc3)nc2)S(=O)O)c1 |
| InChI | InChI=1S/C23H25N3O4S/c1-3-25(4-2)23(27)19-10-8-9-18(15-19)17-26(31(28)29)20-13-14-22(24-16-20)30-21-11-6-5-7-12-21/h5-16H,3-4,17H2,1-2H3,(H,28,29) |
| InChIKey | POQAIIMTBSAMKA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|