C23H23N3O5S — CID 68823912
N-[[3-(morpholine-4-carbonyl)phenyl]methyl]-6-phenoxypyridine-3-sulfonamide (PubChem CID 68823912) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is N-[[3-(morpholine-4-carbonyl)phenyl]methyl]-6-phenoxypyridine-3-sulfonamide.
| Compound Name | N-[[3-(morpholine-4-carbonyl)phenyl]methyl]-6-phenoxypyridine-3-sulfonamide |
|---|---|
| PubChem CID | 68823912 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[[3-(morpholine-4-carbonyl)phenyl]methyl]-6-phenoxypyridine-3-sulfonamide |
| SMILES | O=C(c1cccc(CNS(=O)(=O)c2ccc(Oc3ccccc3)nc2)c1)N1CCOCC1 |
| InChI | InChI=1S/C23H23N3O5S/c27-23(26-11-13-30-14-12-26)19-6-4-5-18(15-19)16-25-32(28,29)21-9-10-22(24-17-21)31-20-7-2-1-3-8-20/h1-10,15,17,25H,11-14,16H2 |
| InChIKey | ONMNTUIYNAGQGQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |