C27H34O6 — CID 68829539
1-[2-methoxy-4,6-bis(methoxymethyl)phenyl]-3-[4-(methoxymethyl)-3-(3-methylbut-2-enoxy)phenyl]prop-2-en-1-one (PubChem CID 68829539) has the molecular formula C27H34O6 and a molecular weight of 454.56 g/mol. Its IUPAC name is 1-[2-methoxy-4,6-bis(methoxymethyl)phenyl]-3-[4-(methoxymethyl)-3-(3-methylbut-2-enoxy)phenyl]prop-2-en-1-one.
| Compound Name | 1-[2-methoxy-4,6-bis(methoxymethyl)phenyl]-3-[4-(methoxymethyl)-3-(3-methylbut-2-enoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68829539 |
| Molecular Formula | C27H34O6 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 1-[2-methoxy-4,6-bis(methoxymethyl)phenyl]-3-[4-(methoxymethyl)-3-(3-methylbut-2-enoxy)phenyl]prop-2-en-1-one |
| SMILES | COCc1cc(COC)c(C(=O)C=Cc2ccc(COC)c(OCC=C(C)C)c2)c(OC)c1 |
| InChI | InChI=1S/C27H34O6/c1-19(2)11-12-33-25-14-20(7-9-22(25)17-30-4)8-10-24(28)27-23(18-31-5)13-21(16-29-3)15-26(27)32-6/h7-11,13-15H,12,16-18H2,1-6H3 |
| InChIKey | OUKVINJJNGAHAH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|