C9H16N4OS — CID 68832852
5-[1-(butylamino)ethyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 68832852) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 5-[1-(butylamino)ethyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[1-(butylamino)ethyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 68832852 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 5-[1-(butylamino)ethyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCCCNC(C)c1nnc(C(N)=O)s1 |
| InChI | InChI=1S/C9H16N4OS/c1-3-4-5-11-6(2)8-12-13-9(15-8)7(10)14/h6,11H,3-5H2,1-2H3,(H2,10,14) |
| InChIKey | RAXVTEPIYNWPEH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|