C12H20N4O3S — CID 166394650
5-(2-hexoxypropanoylamino)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 166394650) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 5-(2-hexoxypropanoylamino)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-(2-hexoxypropanoylamino)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 166394650 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 5-(2-hexoxypropanoylamino)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCCCCCOC(C)C(=O)Nc1nnc(C(N)=O)s1 |
| InChI | InChI=1S/C12H20N4O3S/c1-3-4-5-6-7-19-8(2)10(18)14-12-16-15-11(20-12)9(13)17/h8H,3-7H2,1-2H3,(H2,13,17)(H,14,16,18) |
| InChIKey | VEUFPRIMVDXMNR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|