C21H29F2N5O2S — CID 91290153
N-[5-[1-(butylamino)ethyl]-1,3,4-thiadiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide (PubChem CID 91290153) has the molecular formula C21H29F2N5O2S and a molecular weight of 453.56 g/mol. Its IUPAC name is N-[5-[1-(butylamino)ethyl]-1,3,4-thiadiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide.
| Compound Name | N-[5-[1-(butylamino)ethyl]-1,3,4-thiadiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 91290153 |
| Molecular Formula | C21H29F2N5O2S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | N-[5-[1-(butylamino)ethyl]-1,3,4-thiadiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide |
| SMILES | CCCCNC(C)c1nnc(NC(=O)C(CCC)NC(=O)Cc2cc(F)cc(F)c2)s1 |
| InChI | InChI=1S/C21H29F2N5O2S/c1-4-6-8-24-13(3)20-27-28-21(31-20)26-19(30)17(7-5-2)25-18(29)11-14-9-15(22)12-16(23)10-14/h9-10,12-13,17,24H,4-8,11H2,1-3H3,(H,25,29)(H,26,28,30) |
| InChIKey | HITUHENJLJAMNW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|