C14H21ClFNO3S — CID 68835906
2-chloro-4-fluoro-N-[(4R)-5-hydroxy-2-methylheptan-4-yl]benzenesulfonamide (PubChem CID 68835906) has the molecular formula C14H21ClFNO3S and a molecular weight of 337.84 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[(4R)-5-hydroxy-2-methylheptan-4-yl]benzenesulfonamide.
| Compound Name | 2-chloro-4-fluoro-N-[(4R)-5-hydroxy-2-methylheptan-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 68835906 |
| Molecular Formula | C14H21ClFNO3S |
| Molecular Weight | 337.84 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-chloro-4-fluoro-N-[(4R)-5-hydroxy-2-methylheptan-4-yl]benzenesulfonamide |
| SMILES | CCC(O)[C@@H](CC(C)C)NS(=O)(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H21ClFNO3S/c1-4-13(18)12(7-9(2)3)17-21(19,20)14-6-5-10(16)8-11(14)15/h5-6,8-9,12-13,17-18H,4,7H2,1-3H3/t12-,13?/m1/s1 |
| InChIKey | LGIWSWFKURUWTJ-PZORYLMUSA-N |
| XLogP | 2.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.84 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |