C21H31N5O2S — CID 68836017
2-butyl-1-[4-(1,1-dihydroxy-1,2-thiazolidin-2-yl)butyl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 68836017) has the molecular formula C21H31N5O2S and a molecular weight of 417.58 g/mol. Its IUPAC name is 2-butyl-1-[4-(1,1-dihydroxy-1,2-thiazolidin-2-yl)butyl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-butyl-1-[4-(1,1-dihydroxy-1,2-thiazolidin-2-yl)butyl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 68836017 |
| Molecular Formula | C21H31N5O2S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 2-butyl-1-[4-(1,1-dihydroxy-1,2-thiazolidin-2-yl)butyl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCN1CCCS1(O)O |
| InChI | InChI=1S/C21H31N5O2S/c1-2-3-11-18-24-19-20(16-9-4-5-10-17(16)23-21(19)22)26(18)14-7-6-12-25-13-8-15-29(25,27)28/h4-5,9-10,27-28H,2-3,6-8,11-15H2,1H3,(H2,22,23) |
| InChIKey | QKOJWTPMOVGLOM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|