C19H17BrN2O — CID 68841468
N-[3-bromo-5-[(4-methoxyphenyl)methyl]phenyl]pyridin-3-amine (PubChem CID 68841468) has the molecular formula C19H17BrN2O and a molecular weight of 369.26 g/mol. Its IUPAC name is N-[3-bromo-5-[(4-methoxyphenyl)methyl]phenyl]pyridin-3-amine.
| Compound Name | N-[3-bromo-5-[(4-methoxyphenyl)methyl]phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 68841468 |
| Molecular Formula | C19H17BrN2O |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | N-[3-bromo-5-[(4-methoxyphenyl)methyl]phenyl]pyridin-3-amine |
| SMILES | COc1ccc(Cc2cc(Br)cc(Nc3cccnc3)c2)cc1 |
| InChI | InChI=1S/C19H17BrN2O/c1-23-19-6-4-14(5-7-19)9-15-10-16(20)12-18(11-15)22-17-3-2-8-21-13-17/h2-8,10-13,22H,9H2,1H3 |
| InChIKey | LVCXOTGVRTZEAO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |