C20H28O2 — CID 68842163
3,7-dimethylnon-6-en-3-yl 3-phenylprop-2-enoate (PubChem CID 68842163) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 3,7-dimethylnon-6-en-3-yl 3-phenylprop-2-enoate.
| Compound Name | 3,7-dimethylnon-6-en-3-yl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 68842163 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 3,7-dimethylnon-6-en-3-yl 3-phenylprop-2-enoate |
| SMILES | CCC(C)=CCCC(C)(CC)OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C20H28O2/c1-5-17(3)11-10-16-20(4,6-2)22-19(21)15-14-18-12-8-7-9-13-18/h7-9,11-15H,5-6,10,16H2,1-4H3 |
| InChIKey | NRKODCIHXFCNBT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|