C20H16Cl2N2O4 — CID 68846032
3-chloro-4-cyanobenzamide;3-[1-(2-chlorophenyl)cyclopropyl]-2-oxopropanoic acid (PubChem CID 68846032) has the molecular formula C20H16Cl2N2O4 and a molecular weight of 419.26 g/mol. Its IUPAC name is 3-chloro-4-cyanobenzamide;3-[1-(2-chlorophenyl)cyclopropyl]-2-oxopropanoic acid.
| Compound Name | 3-chloro-4-cyanobenzamide;3-[1-(2-chlorophenyl)cyclopropyl]-2-oxopropanoic acid |
|---|---|
| PubChem CID | 68846032 |
| Molecular Formula | C20H16Cl2N2O4 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 3-chloro-4-cyanobenzamide;3-[1-(2-chlorophenyl)cyclopropyl]-2-oxopropanoic acid |
| SMILES | N#Cc1ccc(C(N)=O)cc1Cl.O=C(O)C(=O)CC1(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C12H11ClO3.C8H5ClN2O/c13-9-4-2-1-3-8(9)12(5-6-12)7-10(14)11(15)16;9-7-3-5(8(11)12)1-2-6(7)4-10/h1-4H,5-7H2,(H,15,16);1-3H,(H2,11,12) |
| InChIKey | VTHGTIHBSARVGH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|