C19H20ClN3O3S — CID 133319980
4-[[4-(2-chlorophenyl)oxan-4-yl]methylamino]-3-cyanobenzenesulfonamide (PubChem CID 133319980) has the molecular formula C19H20ClN3O3S and a molecular weight of 405.91 g/mol. Its IUPAC name is 4-[[4-(2-chlorophenyl)oxan-4-yl]methylamino]-3-cyanobenzenesulfonamide.
| Compound Name | 4-[[4-(2-chlorophenyl)oxan-4-yl]methylamino]-3-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 133319980 |
| Molecular Formula | C19H20ClN3O3S |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 4-[[4-(2-chlorophenyl)oxan-4-yl]methylamino]-3-cyanobenzenesulfonamide |
| SMILES | N#Cc1cc(S(N)(=O)=O)ccc1NCC1(c2ccccc2Cl)CCOCC1 |
| InChI | InChI=1S/C19H20ClN3O3S/c20-17-4-2-1-3-16(17)19(7-9-26-10-8-19)13-23-18-6-5-15(27(22,24)25)11-14(18)12-21/h1-6,11,23H,7-10,13H2,(H2,22,24,25) |
| InChIKey | LZDCWKDZLDLPBL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |