C21H22ClN3O5 — CID 133319989
3-[2-[[4-(2-chlorophenyl)oxan-4-yl]methylamino]-5-nitrophenyl]-1,3-oxazolidin-2-one (PubChem CID 133319989) has the molecular formula C21H22ClN3O5 and a molecular weight of 431.88 g/mol. Its IUPAC name is 3-[2-[[4-(2-chlorophenyl)oxan-4-yl]methylamino]-5-nitrophenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[[4-(2-chlorophenyl)oxan-4-yl]methylamino]-5-nitrophenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 133319989 |
| Molecular Formula | C21H22ClN3O5 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 3-[2-[[4-(2-chlorophenyl)oxan-4-yl]methylamino]-5-nitrophenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1cc([N+](=O)[O-])ccc1NCC1(c2ccccc2Cl)CCOCC1 |
| InChI | InChI=1S/C21H22ClN3O5/c22-17-4-2-1-3-16(17)21(7-10-29-11-8-21)14-23-18-6-5-15(25(27)28)13-19(18)24-9-12-30-20(24)26/h1-6,13,23H,7-12,14H2 |
| InChIKey | FRPJPBFNTQRUPH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|