C15H15N3O4S — CID 71998112
3-[5-nitro-2-(2-thiophen-2-ylethylamino)phenyl]-1,3-oxazolidin-2-one (PubChem CID 71998112) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is 3-[5-nitro-2-(2-thiophen-2-ylethylamino)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[5-nitro-2-(2-thiophen-2-ylethylamino)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71998112 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-[5-nitro-2-(2-thiophen-2-ylethylamino)phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1cc([N+](=O)[O-])ccc1NCCc1cccs1 |
| InChI | InChI=1S/C15H15N3O4S/c19-15-17(7-8-22-15)14-10-11(18(20)21)3-4-13(14)16-6-5-12-2-1-9-23-12/h1-4,9-10,16H,5-8H2 |
| InChIKey | XHCSXPYBTKDYBZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|