C22H23N5O4 — CID 133380192
3-[5-nitro-2-[(1-phenyl-3-propan-2-ylpyrazol-4-yl)methylamino]phenyl]-1,3-oxazolidin-2-one (PubChem CID 133380192) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 3-[5-nitro-2-[(1-phenyl-3-propan-2-ylpyrazol-4-yl)methylamino]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[5-nitro-2-[(1-phenyl-3-propan-2-ylpyrazol-4-yl)methylamino]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 133380192 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 3-[5-nitro-2-[(1-phenyl-3-propan-2-ylpyrazol-4-yl)methylamino]phenyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)c1nn(-c2ccccc2)cc1CNc1ccc([N+](=O)[O-])cc1N1CCOC1=O |
| InChI | InChI=1S/C22H23N5O4/c1-15(2)21-16(14-26(24-21)17-6-4-3-5-7-17)13-23-19-9-8-18(27(29)30)12-20(19)25-10-11-31-22(25)28/h3-9,12,14-15,23H,10-11,13H2,1-2H3 |
| InChIKey | WNTINMGVSJABRF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|