C20H20N4O4 — CID 133320785
3-[2-[3-(1H-indol-3-yl)propylamino]-5-nitrophenyl]-1,3-oxazolidin-2-one (PubChem CID 133320785) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-[2-[3-(1H-indol-3-yl)propylamino]-5-nitrophenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[3-(1H-indol-3-yl)propylamino]-5-nitrophenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 133320785 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-[2-[3-(1H-indol-3-yl)propylamino]-5-nitrophenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1cc([N+](=O)[O-])ccc1NCCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H20N4O4/c25-20-23(10-11-28-20)19-12-15(24(26)27)7-8-18(19)21-9-3-4-14-13-22-17-6-2-1-5-16(14)17/h1-2,5-8,12-13,21-22H,3-4,9-11H2 |
| InChIKey | YFBOMSSNQOPOGU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|