C17H36N4O2 — CID 68846094
tert-butyl N-[(3R)-3-ethylpyrrolidin-3-yl]carbamate;1-ethylpyrrolidin-3-amine (PubChem CID 68846094) has the molecular formula C17H36N4O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is tert-butyl N-[(3R)-3-ethylpyrrolidin-3-yl]carbamate;1-ethylpyrrolidin-3-amine.
| Compound Name | tert-butyl N-[(3R)-3-ethylpyrrolidin-3-yl]carbamate;1-ethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 68846094 |
| Molecular Formula | C17H36N4O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | tert-butyl N-[(3R)-3-ethylpyrrolidin-3-yl]carbamate;1-ethylpyrrolidin-3-amine |
| SMILES | CCN1CCC(N)C1.CC[C@@]1(NC(=O)OC(C)(C)C)CCNC1 |
| InChI | InChI=1S/C11H22N2O2.C6H14N2/c1-5-11(6-7-12-8-11)13-9(14)15-10(2,3)4;1-2-8-4-3-6(7)5-8/h12H,5-8H2,1-4H3,(H,13,14);6H,2-5,7H2,1H3/t11-;/m1./s1 |
| InChIKey | IRLOBBWJBGKTIN-RFVHGSKJSA-N |
| XLogP | 1.69 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |