C28H33N3O6 — CID 68854493
2-[3-[(N-ethyl-3-methoxyanilino)methyl]phenoxy]ethyl 4-(furan-2-carbonyl)piperazine-1-carboxylate (PubChem CID 68854493) has the molecular formula C28H33N3O6 and a molecular weight of 507.59 g/mol. Its IUPAC name is 2-[3-[(N-ethyl-3-methoxyanilino)methyl]phenoxy]ethyl 4-(furan-2-carbonyl)piperazine-1-carboxylate.
| Compound Name | 2-[3-[(N-ethyl-3-methoxyanilino)methyl]phenoxy]ethyl 4-(furan-2-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 68854493 |
| Molecular Formula | C28H33N3O6 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 2-[3-[(N-ethyl-3-methoxyanilino)methyl]phenoxy]ethyl 4-(furan-2-carbonyl)piperazine-1-carboxylate |
| SMILES | CCN(Cc1cccc(OCCOC(=O)N2CCN(C(=O)c3ccco3)CC2)c1)c1cccc(OC)c1 |
| InChI | InChI=1S/C28H33N3O6/c1-3-29(23-8-5-9-24(20-23)34-2)21-22-7-4-10-25(19-22)35-17-18-37-28(33)31-14-12-30(13-15-31)27(32)26-11-6-16-36-26/h4-11,16,19-20H,3,12-15,17-18,21H2,1-2H3 |
| InChIKey | OPSGUNSIHJLCOF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 84.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|