C41H46N2 — CID 68854577
4-[2-[[4-(diethylamino)-2-methylphenyl]-diphenylmethyl]phenyl]-N,N-diethyl-3-methylaniline (PubChem CID 68854577) has the molecular formula C41H46N2 and a molecular weight of 566.83 g/mol. Its IUPAC name is 4-[2-[[4-(diethylamino)-2-methylphenyl]-diphenylmethyl]phenyl]-N,N-diethyl-3-methylaniline.
| Compound Name | 4-[2-[[4-(diethylamino)-2-methylphenyl]-diphenylmethyl]phenyl]-N,N-diethyl-3-methylaniline |
|---|---|
| PubChem CID | 68854577 |
| Molecular Formula | C41H46N2 |
| Molecular Weight | 566.83 g/mol |
| Exact Mass | 566.37 |
| IUPAC Name | 4-[2-[[4-(diethylamino)-2-methylphenyl]-diphenylmethyl]phenyl]-N,N-diethyl-3-methylaniline |
| SMILES | CCN(CC)c1ccc(-c2ccccc2C(c2ccccc2)(c2ccccc2)c2ccc(N(CC)CC)cc2C)c(C)c1 |
| InChI | InChI=1S/C41H46N2/c1-7-42(8-2)35-25-27-37(31(5)29-35)38-23-17-18-24-40(38)41(33-19-13-11-14-20-33,34-21-15-12-16-22-34)39-28-26-36(30-32(39)6)43(9-3)10-4/h11-30H,7-10H2,1-6H3 |
| InChIKey | OMWPTXMNRRSXMA-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.83 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|