C17H17NO — CID 68857612
5-(2-phenylethylamino)-2,3-dihydroinden-1-one (PubChem CID 68857612) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 5-(2-phenylethylamino)-2,3-dihydroinden-1-one.
| Compound Name | 5-(2-phenylethylamino)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 68857612 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 5-(2-phenylethylamino)-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cc(NCCc3ccccc3)ccc21 |
| InChI | InChI=1S/C17H17NO/c19-17-9-6-14-12-15(7-8-16(14)17)18-11-10-13-4-2-1-3-5-13/h1-5,7-8,12,18H,6,9-11H2 |
| InChIKey | OGSCLHNHKVBCDW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |