C21H24N2 — CID 68859251
2,4-dibenzyl-2-methylcyclohexa-3,5-diene-1,3-diamine (PubChem CID 68859251) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 2,4-dibenzyl-2-methylcyclohexa-3,5-diene-1,3-diamine.
| Compound Name | 2,4-dibenzyl-2-methylcyclohexa-3,5-diene-1,3-diamine |
|---|---|
| PubChem CID | 68859251 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 2,4-dibenzyl-2-methylcyclohexa-3,5-diene-1,3-diamine |
| SMILES | CC1(Cc2ccccc2)C(N)=C(Cc2ccccc2)C=CC1N |
| InChI | InChI=1S/C21H24N2/c1-21(15-17-10-6-3-7-11-17)19(22)13-12-18(20(21)23)14-16-8-4-2-5-9-16/h2-13,19H,14-15,22-23H2,1H3 |
| InChIKey | GSUWLNXSQSTZSN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |