C15H14N2O2 — CID 68861508
(2E)-2-(8-prop-1-en-2-yl-7,8-dihydropyrido[4,3-e]pyrrolizin-6-ylidene)acetic acid (PubChem CID 68861508) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2E)-2-(8-prop-1-en-2-yl-7,8-dihydropyrido[4,3-e]pyrrolizin-6-ylidene)acetic acid.
| Compound Name | (2E)-2-(8-prop-1-en-2-yl-7,8-dihydropyrido[4,3-e]pyrrolizin-6-ylidene)acetic acid |
|---|---|
| PubChem CID | 68861508 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (2E)-2-(8-prop-1-en-2-yl-7,8-dihydropyrido[4,3-e]pyrrolizin-6-ylidene)acetic acid |
| SMILES | C=C(C)C1C/C(=C\C(=O)O)c2cc3cnccc3n21 |
| InChI | InChI=1S/C15H14N2O2/c1-9(2)13-5-10(7-15(18)19)14-6-11-8-16-4-3-12(11)17(13)14/h3-4,6-8,13H,1,5H2,2H3,(H,18,19)/b10-7+ |
| InChIKey | NQPOAZFDNCWKDT-JXMROGBWSA-N |
| XLogP | 3.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|