C25H24N4O4 — CID 68863403
N'-(3-cyano-4-hydroxybenzoyl)-3-phenyl-4-(piperidin-1-ylmethyl)furan-2-carbohydrazide (PubChem CID 68863403) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is N'-(3-cyano-4-hydroxybenzoyl)-3-phenyl-4-(piperidin-1-ylmethyl)furan-2-carbohydrazide.
| Compound Name | N'-(3-cyano-4-hydroxybenzoyl)-3-phenyl-4-(piperidin-1-ylmethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 68863403 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N'-(3-cyano-4-hydroxybenzoyl)-3-phenyl-4-(piperidin-1-ylmethyl)furan-2-carbohydrazide |
| SMILES | N#Cc1cc(C(=O)NNC(=O)c2occ(CN3CCCCC3)c2-c2ccccc2)ccc1O |
| InChI | InChI=1S/C25H24N4O4/c26-14-19-13-18(9-10-21(19)30)24(31)27-28-25(32)23-22(17-7-3-1-4-8-17)20(16-33-23)15-29-11-5-2-6-12-29/h1,3-4,7-10,13,16,30H,2,5-6,11-12,15H2,(H,27,31)(H,28,32) |
| InChIKey | AVCZFWZQNCOKOJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|