C16H13ClN2O5S — CID 68866331
6-[(2-chloro-4-methoxyphenyl)sulfonylamino]-1H-indole-7-carboxylic acid (PubChem CID 68866331) has the molecular formula C16H13ClN2O5S and a molecular weight of 380.81 g/mol. Its IUPAC name is 6-[(2-chloro-4-methoxyphenyl)sulfonylamino]-1H-indole-7-carboxylic acid.
| Compound Name | 6-[(2-chloro-4-methoxyphenyl)sulfonylamino]-1H-indole-7-carboxylic acid |
|---|---|
| PubChem CID | 68866331 |
| Molecular Formula | C16H13ClN2O5S |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 6-[(2-chloro-4-methoxyphenyl)sulfonylamino]-1H-indole-7-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc3cc[nH]c3c2C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C16H13ClN2O5S/c1-24-10-3-5-13(11(17)8-10)25(22,23)19-12-4-2-9-6-7-18-15(9)14(12)16(20)21/h2-8,18-19H,1H3,(H,20,21) |
| InChIKey | XWPCWCTXWOVAPE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |