C19H25F3N2O3S — CID 68874794
N-[(3S)-3-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]cyclohexanecarboxamide (PubChem CID 68874794) has the molecular formula C19H25F3N2O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is N-[(3S)-3-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[(3S)-3-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 68874794 |
| Molecular Formula | C19H25F3N2O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[(3S)-3-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]cyclohexanecarboxamide |
| SMILES | O=C(N[C@]1(S(=O)(=O)c2ccccc2C(F)(F)F)CCCNC1)C1CCCCC1 |
| InChI | InChI=1S/C19H25F3N2O3S/c20-19(21,22)15-9-4-5-10-16(15)28(26,27)18(11-6-12-23-13-18)24-17(25)14-7-2-1-3-8-14/h4-5,9-10,14,23H,1-3,6-8,11-13H2,(H,24,25)/t18-/m0/s1 |
| InChIKey | WAHCMFAJMPOKQR-SFHVURJKSA-N |
| XLogP | 3.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |