C15H12IN3O6S2 — CID 68875328
3-iodo-5-[(2-methylsulfonylphenyl)sulfonylamino]indazole-1-carboxylic acid (PubChem CID 68875328) has the molecular formula C15H12IN3O6S2 and a molecular weight of 521.31 g/mol. Its IUPAC name is 3-iodo-5-[(2-methylsulfonylphenyl)sulfonylamino]indazole-1-carboxylic acid.
| Compound Name | 3-iodo-5-[(2-methylsulfonylphenyl)sulfonylamino]indazole-1-carboxylic acid |
|---|---|
| PubChem CID | 68875328 |
| Molecular Formula | C15H12IN3O6S2 |
| Molecular Weight | 521.31 g/mol |
| Exact Mass | 520.92 |
| IUPAC Name | 3-iodo-5-[(2-methylsulfonylphenyl)sulfonylamino]indazole-1-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccccc1S(=O)(=O)Nc1ccc2c(c1)c(I)nn2C(=O)O |
| InChI | InChI=1S/C15H12IN3O6S2/c1-26(22,23)12-4-2-3-5-13(12)27(24,25)18-9-6-7-11-10(8-9)14(16)17-19(11)15(20)21/h2-8,18H,1H3,(H,20,21) |
| InChIKey | FLSKDLNRMBLSMQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|