C23H26N6O3 — CID 68883218
4-[[4-(dimethylamino)quinazolin-2-yl]amino]-N-(3-nitrophenyl)cyclohexane-1-carboxamide (PubChem CID 68883218) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)quinazolin-2-yl]amino]-N-(3-nitrophenyl)cyclohexane-1-carboxamide.
| Compound Name | 4-[[4-(dimethylamino)quinazolin-2-yl]amino]-N-(3-nitrophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 68883218 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 4-[[4-(dimethylamino)quinazolin-2-yl]amino]-N-(3-nitrophenyl)cyclohexane-1-carboxamide |
| SMILES | CN(C)c1nc(NC2CCC(C(=O)Nc3cccc([N+](=O)[O-])c3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C23H26N6O3/c1-28(2)21-19-8-3-4-9-20(19)26-23(27-21)25-16-12-10-15(11-13-16)22(30)24-17-6-5-7-18(14-17)29(31)32/h3-9,14-16H,10-13H2,1-2H3,(H,24,30)(H,25,26,27) |
| InChIKey | HZWAEXRFYXHKHE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|