C23H27N5O3S — CID 142231584
2-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-1-(5-nitrothiophen-3-yl)propan-1-one (PubChem CID 142231584) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is 2-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-1-(5-nitrothiophen-3-yl)propan-1-one.
| Compound Name | 2-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-1-(5-nitrothiophen-3-yl)propan-1-one |
|---|---|
| PubChem CID | 142231584 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]-1-(5-nitrothiophen-3-yl)propan-1-one |
| SMILES | CC(C(=O)c1csc([N+](=O)[O-])c1)C1CCC(Nc2nc(N(C)C)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C23H27N5O3S/c1-14(21(29)16-12-20(28(30)31)32-13-16)15-8-10-17(11-9-15)24-23-25-19-7-5-4-6-18(19)22(26-23)27(2)3/h4-7,12-15,17H,8-11H2,1-3H3,(H,24,25,26) |
| InChIKey | OEMFMTBDPORMGG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|