C29H27N3O5S — CID 68885177
1-benzoyl-N-(furan-2-ylmethyl)-4-(4-phenylphenyl)sulfonylpiperazine-2-carboxamide (PubChem CID 68885177) has the molecular formula C29H27N3O5S and a molecular weight of 529.62 g/mol. Its IUPAC name is 1-benzoyl-N-(furan-2-ylmethyl)-4-(4-phenylphenyl)sulfonylpiperazine-2-carboxamide.
| Compound Name | 1-benzoyl-N-(furan-2-ylmethyl)-4-(4-phenylphenyl)sulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 68885177 |
| Molecular Formula | C29H27N3O5S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | 1-benzoyl-N-(furan-2-ylmethyl)-4-(4-phenylphenyl)sulfonylpiperazine-2-carboxamide |
| SMILES | O=C(NCc1ccco1)C1CN(S(=O)(=O)c2ccc(-c3ccccc3)cc2)CCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H27N3O5S/c33-28(30-20-25-12-7-19-37-25)27-21-31(17-18-32(27)29(34)24-10-5-2-6-11-24)38(35,36)26-15-13-23(14-16-26)22-8-3-1-4-9-22/h1-16,19,27H,17-18,20-21H2,(H,30,33) |
| InChIKey | KTSSUNRPBOTALS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |