C13H13N3O2 — CID 68892890
methyl 1-(3-cyanopropyl)indazole-3-carboxylate (PubChem CID 68892890) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is methyl 1-(3-cyanopropyl)indazole-3-carboxylate.
| Compound Name | methyl 1-(3-cyanopropyl)indazole-3-carboxylate |
|---|---|
| PubChem CID | 68892890 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | methyl 1-(3-cyanopropyl)indazole-3-carboxylate |
| SMILES | COC(=O)c1nn(CCCC#N)c2ccccc12 |
| InChI | InChI=1S/C13H13N3O2/c1-18-13(17)12-10-6-2-3-7-11(10)16(15-12)9-5-4-8-14/h2-3,6-7H,4-5,9H2,1H3 |
| InChIKey | BJOYRGLFUNBFPT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|