C25H22N2O4 — CID 68894491
2-[4-(3-phenoxazin-10-ylpropoxy)-1H-indol-3-yl]acetic acid (PubChem CID 68894491) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-[4-(3-phenoxazin-10-ylpropoxy)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[4-(3-phenoxazin-10-ylpropoxy)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 68894491 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-[4-(3-phenoxazin-10-ylpropoxy)-1H-indol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1c[nH]c2cccc(OCCCN3c4ccccc4Oc4ccccc43)c12 |
| InChI | InChI=1S/C25H22N2O4/c28-24(29)15-17-16-26-18-7-5-12-23(25(17)18)30-14-6-13-27-19-8-1-3-10-21(19)31-22-11-4-2-9-20(22)27/h1-5,7-12,16,26H,6,13-15H2,(H,28,29) |
| InChIKey | YAFGKVBVXMEJBS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|