C26H35NO5 — CID 157301754
2-[2-[2-[(2S)-4-hexyl-2-methyl-3-oxo-1,4-benzoxazin-2-yl]ethoxy]phenyl]acetic acid;methane (PubChem CID 157301754) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is 2-[2-[2-[(2S)-4-hexyl-2-methyl-3-oxo-1,4-benzoxazin-2-yl]ethoxy]phenyl]acetic acid;methane.
| Compound Name | 2-[2-[2-[(2S)-4-hexyl-2-methyl-3-oxo-1,4-benzoxazin-2-yl]ethoxy]phenyl]acetic acid;methane |
|---|---|
| PubChem CID | 157301754 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 2-[2-[2-[(2S)-4-hexyl-2-methyl-3-oxo-1,4-benzoxazin-2-yl]ethoxy]phenyl]acetic acid;methane |
| SMILES | C.CCCCCCN1C(=O)[C@](C)(CCOc2ccccc2CC(=O)O)Oc2ccccc21 |
| InChI | InChI=1S/C25H31NO5.CH4/c1-3-4-5-10-16-26-20-12-7-9-14-22(20)31-25(2,24(26)29)15-17-30-21-13-8-6-11-19(21)18-23(27)28;/h6-9,11-14H,3-5,10,15-18H2,1-2H3,(H,27,28);1H4/t25-;/m0./s1 |
| InChIKey | BBZFWKRPMQEDJZ-UQIIZPHYSA-N |
| XLogP | 5.48 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|