C21H24O9 — CID 68896024
5-hydroxy-3,3,6,7,8-pentamethoxy-2-(4-methoxyphenyl)-2H-chromen-4-one (PubChem CID 68896024) has the molecular formula C21H24O9 and a molecular weight of 420.41 g/mol. Its IUPAC name is 5-hydroxy-3,3,6,7,8-pentamethoxy-2-(4-methoxyphenyl)-2H-chromen-4-one.
| Compound Name | 5-hydroxy-3,3,6,7,8-pentamethoxy-2-(4-methoxyphenyl)-2H-chromen-4-one |
|---|---|
| PubChem CID | 68896024 |
| Molecular Formula | C21H24O9 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 5-hydroxy-3,3,6,7,8-pentamethoxy-2-(4-methoxyphenyl)-2H-chromen-4-one |
| SMILES | COc1ccc(C2Oc3c(OC)c(OC)c(OC)c(O)c3C(=O)C2(OC)OC)cc1 |
| InChI | InChI=1S/C21H24O9/c1-24-12-9-7-11(8-10-12)20-21(28-5,29-6)19(23)13-14(22)16(25-2)18(27-4)17(26-3)15(13)30-20/h7-10,20,22H,1-6H3 |
| InChIKey | JZZABEAHNHUVPW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|