C22H31N3O2 — CID 68898917
3-methyl-1-[4-(3-piperidin-3-ylpropoxy)phenyl]-5,6,7,7a-tetrahydro-4aH-cyclopenta[d]pyridazin-4-one (PubChem CID 68898917) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 3-methyl-1-[4-(3-piperidin-3-ylpropoxy)phenyl]-5,6,7,7a-tetrahydro-4aH-cyclopenta[d]pyridazin-4-one.
| Compound Name | 3-methyl-1-[4-(3-piperidin-3-ylpropoxy)phenyl]-5,6,7,7a-tetrahydro-4aH-cyclopenta[d]pyridazin-4-one |
|---|---|
| PubChem CID | 68898917 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 3-methyl-1-[4-(3-piperidin-3-ylpropoxy)phenyl]-5,6,7,7a-tetrahydro-4aH-cyclopenta[d]pyridazin-4-one |
| SMILES | CN1N=C(c2ccc(OCCCC3CCCNC3)cc2)C2CCCC2C1=O |
| InChI | InChI=1S/C22H31N3O2/c1-25-22(26)20-8-2-7-19(20)21(24-25)17-9-11-18(12-10-17)27-14-4-6-16-5-3-13-23-15-16/h9-12,16,19-20,23H,2-8,13-15H2,1H3 |
| InChIKey | QUCCIGQXUNMUJJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|