C16H26N2O2 — CID 68900392
(4S,5S)-5-amino-4-hydroxy-N-(2-methylpropyl)-6-phenylhexanamide (PubChem CID 68900392) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (4S,5S)-5-amino-4-hydroxy-N-(2-methylpropyl)-6-phenylhexanamide.
| Compound Name | (4S,5S)-5-amino-4-hydroxy-N-(2-methylpropyl)-6-phenylhexanamide |
|---|---|
| PubChem CID | 68900392 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (4S,5S)-5-amino-4-hydroxy-N-(2-methylpropyl)-6-phenylhexanamide |
| SMILES | CC(C)CNC(=O)CC[C@H](O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C16H26N2O2/c1-12(2)11-18-16(20)9-8-15(19)14(17)10-13-6-4-3-5-7-13/h3-7,12,14-15,19H,8-11,17H2,1-2H3,(H,18,20)/t14-,15-/m0/s1 |
| InChIKey | LYMOGNKGUUUOFI-GJZGRUSLSA-N |
| XLogP | 1.47 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |